C24H30ClN5O5 — CID 171816427
(2R,3R,4S,5R)-2-[6-[(4-chlorophenyl)methoxy]-8-[(4-hydroxy-4-methylcyclohexyl)amino]purin-9-yl]-5-methyloxolane-3,4-diol (PubChem CID 171816427) has the molecular formula C24H30ClN5O5 and a molecular weight of 503.99 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[(4-chlorophenyl)methoxy]-8-[(4-hydroxy-4-methylcyclohexyl)amino]purin-9-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[(4-chlorophenyl)methoxy]-8-[(4-hydroxy-4-methylcyclohexyl)amino]purin-9-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 171816427 |
| Molecular Formula | C24H30ClN5O5 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[(4-chlorophenyl)methoxy]-8-[(4-hydroxy-4-methylcyclohexyl)amino]purin-9-yl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](n2c(NC3CCC(C)(O)CC3)nc3c(OCc4ccc(Cl)cc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H30ClN5O5/c1-13-18(31)19(32)22(35-13)30-20-17(29-23(30)28-16-7-9-24(2,33)10-8-16)21(27-12-26-20)34-11-14-3-5-15(25)6-4-14/h3-6,12-13,16,18-19,22,31-33H,7-11H2,1-2H3,(H,28,29)/t13-,16?,18-,19-,22-,24?/m1/s1 |
| InChIKey | LCZVBGSJWKWROO-OWIMZFACSA-N |
| XLogP | 2.80 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |