C7H11NS — CID 171816859
1,4-dimethyl-2,3-dihydropyridine-6-thione (PubChem CID 171816859) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is 1,4-dimethyl-2,3-dihydropyridine-6-thione.
| Compound Name | 1,4-dimethyl-2,3-dihydropyridine-6-thione |
|---|---|
| PubChem CID | 171816859 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 1,4-dimethyl-2,3-dihydropyridine-6-thione |
| SMILES | CC1=CC(=S)N(C)CC1 |
| InChI | InChI=1S/C7H11NS/c1-6-3-4-8(2)7(9)5-6/h5H,3-4H2,1-2H3 |
| InChIKey | TZLYEIDTFANUOW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|