About 1,4-dimethyl-2,3-dihydropyridine-6-thione
1,4-dimethyl-2,3-dihydropyridine-6-thione (PubChem CID 171816859) has the molecular formula C7H11NS
and a molecular weight of 141.24 g/mol. Its IUPAC name is 1,4-dimethyl-2,3-dihydropyridine-6-thione.
Molecular Properties
| Compound Name | 1,4-dimethyl-2,3-dihydropyridine-6-thione |
| PubChem CID | 171816859 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 1,4-dimethyl-2,3-dihydropyridine-6-thione |
| SMILES | CC1=CC(=S)N(C)CC1 |
| InChI | InChI=1S/C7H11NS/c1-6-3-4-8(2)7(9)5-6/h5H,3-4H2,1-2H3 |
| InChIKey | TZLYEIDTFANUOW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethyl-2,3-dihydropyridine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-2,3-dihydropyridine-6-thione?
The IUPAC name of 1,4-dimethyl-2,3-dihydropyridine-6-thione (CID 171816859) is 1,4-dimethyl-2,3-dihydropyridine-6-thione.
What is the SMILES notation for 1,4-dimethyl-2,3-dihydropyridine-6-thione?
The canonical SMILES for 1,4-dimethyl-2,3-dihydropyridine-6-thione is CC1=CC(=S)N(C)CC1.
What is the InChIKey of 1,4-dimethyl-2,3-dihydropyridine-6-thione?
The InChIKey is TZLYEIDTFANUOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS/c1-6-3-4-8(2)7(9)5-6/h5H,3-4H2,1-2H3.
What are the key properties of 1,4-dimethyl-2,3-dihydropyridine-6-thione?
1,4-dimethyl-2,3-dihydropyridine-6-thione has a molecular weight of 141.24 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-2,3-dihydropyridine-6-thione is sourced from PubChem (CID 171816859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).