C29H26BrFIN6O3- — CID 171817386
CID 171817386 (PubChem CID 171817386) has the molecular formula C29H26BrFIN6O3- and a molecular weight of 732.37 g/mol.
| Compound Name | CID 171817386 |
|---|---|
| PubChem CID | 171817386 |
| Molecular Formula | C29H26BrFIN6O3- |
| Molecular Weight | 732.37 g/mol |
| Exact Mass | 731.03 |
| IUPAC Name | — |
| SMILES | CC(=O)c1cn(CC(=O)N2[C@H](C(=O)Nc3nc(Br)ccc3C)C[C@@]3(C)[I-][C@@H]23)c2cc(F)c(-c3cnc(C)nc3)cc12 |
| InChI | InChI=1S/C29H26BrFIN6O3/c1-14-5-6-24(30)35-26(14)36-27(41)23-9-29(4)28(32-29)38(23)25(40)13-37-12-20(15(2)39)19-7-18(21(31)8-22(19)37)17-10-33-16(3)34-11-17/h5-8,10-12,23,28H,9,13H2,1-4H3,(H,35,36,41)/q-1/t23-,28-,29+/m0/s1 |
| InChIKey | HAMXIPZZKNVSPR-WTWMYVDVSA-N |
| XLogP | 1.64 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|