C28H37N9O3 — CID 171818663
ethyl 4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-2-[(1-octylpyrazol-4-yl)amino]pyrimidine-5-carboxylate (PubChem CID 171818663) has the molecular formula C28H37N9O3 and a molecular weight of 547.66 g/mol. Its IUPAC name is ethyl 4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-2-[(1-octylpyrazol-4-yl)amino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-2-[(1-octylpyrazol-4-yl)amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 171818663 |
| Molecular Formula | C28H37N9O3 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.30 |
| IUPAC Name | ethyl 4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-2-[(1-octylpyrazol-4-yl)amino]pyrimidine-5-carboxylate |
| SMILES | CCCCCCCCn1cc(Nc2ncc(C(=O)OCC)c(Nc3cccc(-c4ncn(C)n4)c3OC)n2)cn1 |
| InChI | InChI=1S/C28H37N9O3/c1-5-7-8-9-10-11-15-37-18-20(16-31-37)32-28-29-17-22(27(38)40-6-2)26(34-28)33-23-14-12-13-21(24(23)39-4)25-30-19-36(3)35-25/h12-14,16-19H,5-11,15H2,1-4H3,(H2,29,32,33,34) |
| InChIKey | LLZGDOXPUGNEGL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 133.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|