About [3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid
[3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid (PubChem CID 171818813) has the molecular formula C15H13BN4O3
and a molecular weight of 308.11 g/mol. Its IUPAC name is [3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid.
Molecular Properties
| Compound Name | [3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid |
| PubChem CID | 171818813 |
| Molecular Formula | C15H13BN4O3 |
| Molecular Weight | 308.11 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | [3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid |
| SMILES | C[C@@H](Oc1cc(B(O)O)cn2ncc(C#N)c12)c1ccccn1 |
| InChI | InChI=1S/C15H13BN4O3/c1-10(13-4-2-3-5-18-13)23-14-6-12(16(21)22)9-20-15(14)11(7-17)8-19-20/h2-6,8-10,21-22H,1H3/t10-/m1/s1 |
| InChIKey | OYQFTCZLZXHGIF-SNVBAGLBSA-N |
| XLogP | 0.42 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.11 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid?
The IUPAC name of [3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid (CID 171818813) is [3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid.
What is the SMILES notation for [3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid?
The canonical SMILES for [3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid is C[C@@H](Oc1cc(B(O)O)cn2ncc(C#N)c12)c1ccccn1.
What is the InChIKey of [3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid?
The InChIKey is OYQFTCZLZXHGIF-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H13BN4O3/c1-10(13-4-2-3-5-18-13)23-14-6-12(16(21)22)9-20-15(14)11(7-17)8-19-20/h2-6,8-10,21-22H,1H3/t10-/m1/s1.
What are the key properties of [3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid?
[3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid has a molecular weight of 308.11 g/mol, XLogP of 0.42, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-cyano-4-[(1R)-1-pyridin-2-ylethoxy]pyrazolo[1,5-a]pyridin-6-yl]boronic acid is sourced from PubChem (CID 171818813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).