About 5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine
5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine (PubChem CID 171818871) has the molecular formula C5H5N5S
and a molecular weight of 167.20 g/mol. Its IUPAC name is 5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 171818871 |
| Molecular Formula | C5H5N5S |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(-n2cccn2)s1 |
| InChI | InChI=1S/C5H5N5S/c6-4-8-9-5(11-4)10-3-1-2-7-10/h1-3H,(H2,6,8) |
| InChIKey | PZUPNFOMCXKWAF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine (CID 171818871) is 5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine is Nc1nnc(-n2cccn2)s1.
What is the InChIKey of 5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine?
The InChIKey is PZUPNFOMCXKWAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5S/c6-4-8-9-5(11-4)10-3-1-2-7-10/h1-3H,(H2,6,8).
What are the key properties of 5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine?
5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine has a molecular weight of 167.20 g/mol, XLogP of 0.31, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrazol-1-yl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 171818871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).