About 2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine
2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine (PubChem CID 171819600) has the molecular formula C19H28N2
and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine.
Molecular Properties
| Compound Name | 2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine |
| PubChem CID | 171819600 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine |
| SMILES | [H]/N=C1\C=C(C)C2=NC(C)(CC)C=C(CCCCCC)C2=C1 |
| InChI | InChI=1S/C19H28N2/c1-5-7-8-9-10-15-13-19(4,6-2)21-18-14(3)11-16(20)12-17(15)18/h11-13,20H,5-10H2,1-4H3/b20-16+ |
| InChIKey | XASOCRCNTATTJR-CAPFRKAQSA-N |
| XLogP | 5.41 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine?
The IUPAC name of 2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine (CID 171819600) is 2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine.
What is the SMILES notation for 2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine?
The canonical SMILES for 2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine is [H]/N=C1\C=C(C)C2=NC(C)(CC)C=C(CCCCCC)C2=C1.
What is the InChIKey of 2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine?
The InChIKey is XASOCRCNTATTJR-CAPFRKAQSA-N. The full InChI is InChI=1S/C19H28N2/c1-5-7-8-9-10-15-13-19(4,6-2)21-18-14(3)11-16(20)12-17(15)18/h11-13,20H,5-10H2,1-4H3/b20-16+.
What are the key properties of 2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine?
2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine has a molecular weight of 284.45 g/mol, XLogP of 5.41, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-hexyl-2,8-dimethylquinolin-6-imine is sourced from PubChem (CID 171819600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).