About 8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine
8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine (PubChem CID 171819655) has the molecular formula C21H24N2O
and a molecular weight of 320.44 g/mol. Its IUPAC name is 8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine.
Molecular Properties
| Compound Name | 8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine |
| PubChem CID | 171819655 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine |
| SMILES | COC1=C/C(=N\[C@H](C)c2ccccc2)C=C2C(C)=CC(C)(C)N=C12 |
| InChI | InChI=1S/C21H24N2O/c1-14-13-21(3,4)23-20-18(14)11-17(12-19(20)24-5)22-15(2)16-9-7-6-8-10-16/h6-13,15H,1-5H3/b22-17-/t15-/m1/s1 |
| InChIKey | LDUHCFCSSXZPEK-XQEBGNCTSA-N |
| XLogP | 4.84 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine?
The IUPAC name of 8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine (CID 171819655) is 8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine.
What is the SMILES notation for 8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine?
The canonical SMILES for 8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine is COC1=C/C(=N\[C@H](C)c2ccccc2)C=C2C(C)=CC(C)(C)N=C12.
What is the InChIKey of 8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine?
The InChIKey is LDUHCFCSSXZPEK-XQEBGNCTSA-N. The full InChI is InChI=1S/C21H24N2O/c1-14-13-21(3,4)23-20-18(14)11-17(12-19(20)24-5)22-15(2)16-9-7-6-8-10-16/h6-13,15H,1-5H3/b22-17-/t15-/m1/s1.
What are the key properties of 8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine?
8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine has a molecular weight of 320.44 g/mol, XLogP of 4.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-2,2,4-trimethyl-N-[(1R)-1-phenylethyl]quinolin-6-imine is sourced from PubChem (CID 171819655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).