C20H28N6O3 — CID 171820277
3-amino-6-(ethylamino)-4-(3-hydroxy-2,6-dimethylphenyl)-5-(2-oxoethanimidoyl)pyridine-2-carboxamide;N-methylmethanamine (PubChem CID 171820277) has the molecular formula C20H28N6O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-amino-6-(ethylamino)-4-(3-hydroxy-2,6-dimethylphenyl)-5-(2-oxoethanimidoyl)pyridine-2-carboxamide;N-methylmethanamine.
| Compound Name | 3-amino-6-(ethylamino)-4-(3-hydroxy-2,6-dimethylphenyl)-5-(2-oxoethanimidoyl)pyridine-2-carboxamide;N-methylmethanamine |
|---|---|
| PubChem CID | 171820277 |
| Molecular Formula | C20H28N6O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 3-amino-6-(ethylamino)-4-(3-hydroxy-2,6-dimethylphenyl)-5-(2-oxoethanimidoyl)pyridine-2-carboxamide;N-methylmethanamine |
| SMILES | CNC.[H]/N=C(\C=O)c1c(NCC)nc(C(N)=O)c(N)c1-c1c(C)ccc(O)c1C |
| InChI | InChI=1S/C18H21N5O3.C2H7N/c1-4-22-18-13(10(19)7-24)14(15(20)16(23-18)17(21)26)12-8(2)5-6-11(25)9(12)3;1-3-2/h5-7,19,25H,4,20H2,1-3H3,(H2,21,26)(H,22,23);3H,1-2H3/b19-10+; |
| InChIKey | WXEUFRGKQBJQNH-ZIOFAICLSA-N |
| XLogP | 1.59 |
| TPSA | 167.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|