C24H25N5O2 — CID 171820287
4-amino-5-diazenyl-3-(3-methoxy-2,6-dimethylphenyl)-2-[(4-methoxyphenyl)methylamino]benzonitrile (PubChem CID 171820287) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 4-amino-5-diazenyl-3-(3-methoxy-2,6-dimethylphenyl)-2-[(4-methoxyphenyl)methylamino]benzonitrile.
| Compound Name | 4-amino-5-diazenyl-3-(3-methoxy-2,6-dimethylphenyl)-2-[(4-methoxyphenyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 171820287 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 4-amino-5-diazenyl-3-(3-methoxy-2,6-dimethylphenyl)-2-[(4-methoxyphenyl)methylamino]benzonitrile |
| SMILES | [H]/N=N/c1cc(C#N)c(NCc2ccc(OC)cc2)c(-c2c(C)ccc(OC)c2C)c1N |
| InChI | InChI=1S/C24H25N5O2/c1-14-5-10-20(31-4)15(2)21(14)22-23(26)19(29-27)11-17(12-25)24(22)28-13-16-6-8-18(30-3)9-7-16/h5-11,27-28H,13,26H2,1-4H3/b29-27+ |
| InChIKey | VXMJMMVHCGUALN-ORIPQNMZSA-N |
| XLogP | 5.72 |
| TPSA | 116.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|