About 8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine
8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine (PubChem CID 171820934) has the molecular formula C8H8ClN3
and a molecular weight of 181.63 g/mol. Its IUPAC name is 8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine |
| PubChem CID | 171820934 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine |
| SMILES | Cc1nc(Cl)c2nccn2c1C |
| InChI | InChI=1S/C8H8ClN3/c1-5-6(2)12-4-3-10-8(12)7(9)11-5/h3-4H,1-2H3 |
| InChIKey | FGGPNWSHSSYVGT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine?
The IUPAC name of 8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine (CID 171820934) is 8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine.
What is the SMILES notation for 8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine?
The canonical SMILES for 8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine is Cc1nc(Cl)c2nccn2c1C.
What is the InChIKey of 8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine?
The InChIKey is FGGPNWSHSSYVGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3/c1-5-6(2)12-4-3-10-8(12)7(9)11-5/h3-4H,1-2H3.
What are the key properties of 8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine?
8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine has a molecular weight of 181.63 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-5,6-dimethylimidazo[1,2-a]pyrazine is sourced from PubChem (CID 171820934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).