About 1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone
1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone (PubChem CID 171821692) has the molecular formula C14H16F2N2O
and a molecular weight of 266.29 g/mol. Its IUPAC name is 1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone.
Molecular Properties
| Compound Name | 1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone |
| PubChem CID | 171821692 |
| Molecular Formula | C14H16F2N2O |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone |
| SMILES | CCc1ccc(/C(N)=C/C=N/C(F)F)cc1C(C)=O |
| InChI | InChI=1S/C14H16F2N2O/c1-3-10-4-5-11(8-12(10)9(2)19)13(17)6-7-18-14(15)16/h4-8,14H,3,17H2,1-2H3/b13-6-,18-7+ |
| InChIKey | MCCHXIJXCACSTA-XPFYUDJGSA-N |
| XLogP | 3.04 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone?
The IUPAC name of 1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone (CID 171821692) is 1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone.
What is the SMILES notation for 1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone?
The canonical SMILES for 1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone is CCc1ccc(/C(N)=C/C=N/C(F)F)cc1C(C)=O.
What is the InChIKey of 1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone?
The InChIKey is MCCHXIJXCACSTA-XPFYUDJGSA-N. The full InChI is InChI=1S/C14H16F2N2O/c1-3-10-4-5-11(8-12(10)9(2)19)13(17)6-7-18-14(15)16/h4-8,14H,3,17H2,1-2H3/b13-6-,18-7+.
What are the key properties of 1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone?
1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone has a molecular weight of 266.29 g/mol, XLogP of 3.04, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-enyl]-2-ethylphenyl]ethanone is sourced from PubChem (CID 171821692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).