C27H27F3N8O2 — CID 171822956
4-amino-N',1-dimethyl-N-[[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methyl]-N'-(4-oxobutyl)pyrazolo[4,5-c]quinoline-8-carbohydrazide (PubChem CID 171822956) has the molecular formula C27H27F3N8O2 and a molecular weight of 552.56 g/mol. Its IUPAC name is 4-amino-N',1-dimethyl-N-[[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methyl]-N'-(4-oxobutyl)pyrazolo[4,5-c]quinoline-8-carbohydrazide.
| Compound Name | 4-amino-N',1-dimethyl-N-[[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methyl]-N'-(4-oxobutyl)pyrazolo[4,5-c]quinoline-8-carbohydrazide |
|---|---|
| PubChem CID | 171822956 |
| Molecular Formula | C27H27F3N8O2 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 4-amino-N',1-dimethyl-N-[[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methyl]-N'-(4-oxobutyl)pyrazolo[4,5-c]quinoline-8-carbohydrazide |
| SMILES | CN(CCCC=O)N(Cc1nc2cc(C(F)(F)F)ccc2n1C)C(=O)c1ccc2nc(N)c3cnn(C)c3c2c1 |
| InChI | InChI=1S/C27H27F3N8O2/c1-35(10-4-5-11-39)38(15-23-33-21-13-17(27(28,29)30)7-9-22(21)36(23)2)26(40)16-6-8-20-18(12-16)24-19(25(31)34-20)14-32-37(24)3/h6-9,11-14H,4-5,10,15H2,1-3H3,(H2,31,34) |
| InChIKey | PQWZRGRFFBTHSK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|