C23H25N9O2 — CID 171823285
N'-acetyl-4-amino-N-[[2-diazenyl-3-(methylamino)phenyl]methyl]-N',1-dimethylpyrazolo[4,5-c]quinoline-8-carbohydrazide (PubChem CID 171823285) has the molecular formula C23H25N9O2 and a molecular weight of 459.51 g/mol. Its IUPAC name is N'-acetyl-4-amino-N-[[2-diazenyl-3-(methylamino)phenyl]methyl]-N',1-dimethylpyrazolo[4,5-c]quinoline-8-carbohydrazide.
| Compound Name | N'-acetyl-4-amino-N-[[2-diazenyl-3-(methylamino)phenyl]methyl]-N',1-dimethylpyrazolo[4,5-c]quinoline-8-carbohydrazide |
|---|---|
| PubChem CID | 171823285 |
| Molecular Formula | C23H25N9O2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | N'-acetyl-4-amino-N-[[2-diazenyl-3-(methylamino)phenyl]methyl]-N',1-dimethylpyrazolo[4,5-c]quinoline-8-carbohydrazide |
| SMILES | [H]/N=N/c1c(CN(C(=O)c2ccc3nc(N)c4cnn(C)c4c3c2)N(C)C(C)=O)cccc1NC |
| InChI | InChI=1S/C23H25N9O2/c1-13(33)31(4)32(12-15-6-5-7-19(26-2)20(15)29-25)23(34)14-8-9-18-16(10-14)21-17(22(24)28-18)11-27-30(21)3/h5-11,25-26H,12H2,1-4H3,(H2,24,28)/b29-25+ |
| InChIKey | XLKAXSGKTNQRBB-XLVZBRSZSA-N |
| XLogP | 3.44 |
| TPSA | 145.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|