About 1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate
1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate (PubChem CID 171824263) has the molecular formula C17H19N3O3
and a molecular weight of 313.36 g/mol. Its IUPAC name is 1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate.
Molecular Properties
| Compound Name | 1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate |
| PubChem CID | 171824263 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(C2CC3(CNC3)C2)cc1)OCc1cnco1 |
| InChI | InChI=1S/C17H19N3O3/c21-16(22-8-15-7-18-11-23-15)20-14-3-1-12(2-4-14)13-5-17(6-13)9-19-10-17/h1-4,7,11,13,19H,5-6,8-10H2,(H,20,21) |
| InChIKey | AANFLPQKJXNOLP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate?
The IUPAC name of 1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate (CID 171824263) is 1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate.
What is the SMILES notation for 1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate?
The canonical SMILES for 1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate is O=C(Nc1ccc(C2CC3(CNC3)C2)cc1)OCc1cnco1.
What is the InChIKey of 1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate?
The InChIKey is AANFLPQKJXNOLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O3/c21-16(22-8-15-7-18-11-23-15)20-14-3-1-12(2-4-14)13-5-17(6-13)9-19-10-17/h1-4,7,11,13,19H,5-6,8-10H2,(H,20,21).
What are the key properties of 1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate?
1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate has a molecular weight of 313.36 g/mol, XLogP of 2.89, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-oxazol-5-ylmethyl N-[4-(2-azaspiro[3.3]heptan-6-yl)phenyl]carbamate is sourced from PubChem (CID 171824263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).