C23H30N2O4 — CID 171824486
tert-butyl N-methyl-N-[1-[4-[(4-methylphenyl)methoxycarbonylamino]phenyl]ethyl]carbamate (PubChem CID 171824486) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[1-[4-[(4-methylphenyl)methoxycarbonylamino]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[1-[4-[(4-methylphenyl)methoxycarbonylamino]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 171824486 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | tert-butyl N-methyl-N-[1-[4-[(4-methylphenyl)methoxycarbonylamino]phenyl]ethyl]carbamate |
| SMILES | Cc1ccc(COC(=O)Nc2ccc(C(C)N(C)C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H30N2O4/c1-16-7-9-18(10-8-16)15-28-21(26)24-20-13-11-19(12-14-20)17(2)25(6)22(27)29-23(3,4)5/h7-14,17H,15H2,1-6H3,(H,24,26) |
| InChIKey | BXWPJHOXIUYXMY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |