C26H31N2O4P — CID 171825229
ethane;10-hydroxy-19-methyl-18-phosphanyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione (PubChem CID 171825229) has the molecular formula C26H31N2O4P and a molecular weight of 466.52 g/mol. Its IUPAC name is ethane;10-hydroxy-19-methyl-18-phosphanyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione.
| Compound Name | ethane;10-hydroxy-19-methyl-18-phosphanyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione |
|---|---|
| PubChem CID | 171825229 |
| Molecular Formula | C26H31N2O4P |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | ethane;10-hydroxy-19-methyl-18-phosphanyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione |
| SMILES | CC.CC.Cc1c(P)cc2nc3c(c4c2c1CCC4)Cn1c-3cc2c(c1=O)COC(=O)C2O |
| InChI | InChI=1S/C22H19N2O4P.2C2H6/c1-9-10-3-2-4-11-13-7-24-16(19(13)23-15(18(10)11)6-17(9)29)5-12-14(21(24)26)8-28-22(27)20(12)25;2*1-2/h5-6,20,25H,2-4,7-8,29H2,1H3;2*1-2H3 |
| InChIKey | VYPILCLLHCZIFE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|