C9H10F3NO2 — CID 171825637
5-(2-methoxyethyl)-4-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 171825637) has the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. Its IUPAC name is 5-(2-methoxyethyl)-4-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 5-(2-methoxyethyl)-4-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 171825637 |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 5-(2-methoxyethyl)-4-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | COCCc1c[nH]c(=O)cc1C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO2/c1-15-3-2-6-5-13-8(14)4-7(6)9(10,11)12/h4-5H,2-3H2,1H3,(H,13,14) |
| InChIKey | WCOZTITWWIUPNE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |