C13H15FN2O — CID 171826048
3-(4-fluoro-3-methylphenoxy)-1,4,5-trimethylpyrazole (PubChem CID 171826048) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is 3-(4-fluoro-3-methylphenoxy)-1,4,5-trimethylpyrazole.
| Compound Name | 3-(4-fluoro-3-methylphenoxy)-1,4,5-trimethylpyrazole |
|---|---|
| PubChem CID | 171826048 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 3-(4-fluoro-3-methylphenoxy)-1,4,5-trimethylpyrazole |
| SMILES | Cc1cc(Oc2nn(C)c(C)c2C)ccc1F |
| InChI | InChI=1S/C13H15FN2O/c1-8-7-11(5-6-12(8)14)17-13-9(2)10(3)16(4)15-13/h5-7H,1-4H3 |
| InChIKey | BRFGHOAPHIFHAD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |