About 5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene
5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene (PubChem CID 171826350) has the molecular formula C13H15F5N2O
and a molecular weight of 310.27 g/mol. Its IUPAC name is 5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene.
Molecular Properties
| Compound Name | 5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene |
| PubChem CID | 171826350 |
| Molecular Formula | C13H15F5N2O |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene |
| SMILES | C=CF.O=c1cc(C(F)(F)F)c(CCN2CC(F)C2)c[nH]1 |
| InChI | InChI=1S/C11H12F4N2O.C2H3F/c12-8-5-17(6-8)2-1-7-4-16-10(18)3-9(7)11(13,14)15;1-2-3/h3-4,8H,1-2,5-6H2,(H,16,18);2H,1H2 |
| InChIKey | LZLZZPSBKWEISV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene?
The IUPAC name of 5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene (CID 171826350) is 5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene.
What is the SMILES notation for 5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene?
The canonical SMILES for 5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene is C=CF.O=c1cc(C(F)(F)F)c(CCN2CC(F)C2)c[nH]1.
What is the InChIKey of 5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene?
The InChIKey is LZLZZPSBKWEISV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F4N2O.C2H3F/c12-8-5-17(6-8)2-1-7-4-16-10(18)3-9(7)11(13,14)15;1-2-3/h3-4,8H,1-2,5-6H2,(H,16,18);2H,1H2.
What are the key properties of 5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene?
5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene has a molecular weight of 310.27 g/mol, XLogP of 2.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3-fluoroazetidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one;fluoroethene is sourced from PubChem (CID 171826350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).