About 5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one
5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 171826361) has the molecular formula C13H15F5N2O
and a molecular weight of 310.27 g/mol. Its IUPAC name is 5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one |
| PubChem CID | 171826361 |
| Molecular Formula | C13H15F5N2O |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1cc(C(F)(F)F)c(CCN2CCC(F)(F)CC2)c[nH]1 |
| InChI | InChI=1S/C13H15F5N2O/c14-12(15)2-5-20(6-3-12)4-1-9-8-19-11(21)7-10(9)13(16,17)18/h7-8H,1-6H2,(H,19,21) |
| InChIKey | GNNOYFYESCXCMN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one?
The IUPAC name of 5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one (CID 171826361) is 5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one.
What is the SMILES notation for 5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one?
The canonical SMILES for 5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one is O=c1cc(C(F)(F)F)c(CCN2CCC(F)(F)CC2)c[nH]1.
What is the InChIKey of 5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one?
The InChIKey is GNNOYFYESCXCMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F5N2O/c14-12(15)2-5-20(6-3-12)4-1-9-8-19-11(21)7-10(9)13(16,17)18/h7-8H,1-6H2,(H,19,21).
What are the key properties of 5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one?
5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one has a molecular weight of 310.27 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-(trifluoromethyl)-1H-pyridin-2-one is sourced from PubChem (CID 171826361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).