About 2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane
2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane (PubChem CID 171826659) has the molecular formula C15H20FN3O
and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane.
Molecular Properties
| Compound Name | 2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane |
| PubChem CID | 171826659 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane |
| SMILES | CC.CNc1c(C)nnc(-c2ccc(F)cc2O)c1C |
| InChI | InChI=1S/C13H14FN3O.C2H6/c1-7-12(15-3)8(2)16-17-13(7)10-5-4-9(14)6-11(10)18;1-2/h4-6,18H,1-3H3,(H,15,17);1-2H3 |
| InChIKey | MGJSUACCHGBWEZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane?
The IUPAC name of 2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane (CID 171826659) is 2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane.
What is the SMILES notation for 2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane?
The canonical SMILES for 2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane is CC.CNc1c(C)nnc(-c2ccc(F)cc2O)c1C.
What is the InChIKey of 2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane?
The InChIKey is MGJSUACCHGBWEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FN3O.C2H6/c1-7-12(15-3)8(2)16-17-13(7)10-5-4-9(14)6-11(10)18;1-2/h4-6,18H,1-3H3,(H,15,17);1-2H3.
What are the key properties of 2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane?
2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane has a molecular weight of 277.34 g/mol, XLogP of 3.67, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,6-dimethyl-5-(methylamino)pyridazin-3-yl]-5-fluorophenol;ethane is sourced from PubChem (CID 171826659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).