About 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide
5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide (PubChem CID 171827629) has the molecular formula C22H20N4O3
and a molecular weight of 388.43 g/mol. Its IUPAC name is 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide |
| PubChem CID | 171827629 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide |
| SMILES | Cc1ccc(O)c(C)c1-n1nc(-c2cc(-c3ccccc3)co2)c(C(N)=O)c1N |
| InChI | InChI=1S/C22H20N4O3/c1-12-8-9-16(27)13(2)20(12)26-21(23)18(22(24)28)19(25-26)17-10-15(11-29-17)14-6-4-3-5-7-14/h3-11,27H,23H2,1-2H3,(H2,24,28) |
| InChIKey | PPDPXNFAMVRLLP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide?
The IUPAC name of 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide (CID 171827629) is 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide.
What is the SMILES notation for 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide?
The canonical SMILES for 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide is Cc1ccc(O)c(C)c1-n1nc(-c2cc(-c3ccccc3)co2)c(C(N)=O)c1N.
What is the InChIKey of 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide?
The InChIKey is PPDPXNFAMVRLLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4O3/c1-12-8-9-16(27)13(2)20(12)26-21(23)18(22(24)28)19(25-26)17-10-15(11-29-17)14-6-4-3-5-7-14/h3-11,27H,23H2,1-2H3,(H2,24,28).
What are the key properties of 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide?
5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide has a molecular weight of 388.43 g/mol, XLogP of 3.80, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-(3-hydroxy-2,6-dimethylphenyl)-3-(4-phenylfuran-2-yl)pyrazole-4-carboxamide is sourced from PubChem (CID 171827629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).