C17H23NO4 — CID 171828759
ethyl (4R)-2-ethyl-4,6,10-trimethyl-3,8-dioxo-2-azaspiro[4.5]deca-6,9-diene-4-carboxylate (PubChem CID 171828759) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is ethyl (4R)-2-ethyl-4,6,10-trimethyl-3,8-dioxo-2-azaspiro[4.5]deca-6,9-diene-4-carboxylate.
| Compound Name | ethyl (4R)-2-ethyl-4,6,10-trimethyl-3,8-dioxo-2-azaspiro[4.5]deca-6,9-diene-4-carboxylate |
|---|---|
| PubChem CID | 171828759 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | ethyl (4R)-2-ethyl-4,6,10-trimethyl-3,8-dioxo-2-azaspiro[4.5]deca-6,9-diene-4-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)C(=O)N(CC)CC12C(C)=CC(=O)C=C2C |
| InChI | InChI=1S/C17H23NO4/c1-6-18-10-17(11(3)8-13(19)9-12(17)4)16(5,14(18)20)15(21)22-7-2/h8-9H,6-7,10H2,1-5H3/t16-/m1/s1 |
| InChIKey | LKBYHQMVALTZDF-MRXNPFEDSA-N |
| XLogP | 1.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|