C21H19ClF2N4O2 — CID 171829531
5-chloro-2-[4-[[(1R,2R)-3-(2,2-difluoroethylidene)-2-hydroxycyclohexyl]amino]pyrido[3,4-d]pyridazin-1-yl]phenol (PubChem CID 171829531) has the molecular formula C21H19ClF2N4O2 and a molecular weight of 432.86 g/mol. Its IUPAC name is 5-chloro-2-[4-[[(1R,2R)-3-(2,2-difluoroethylidene)-2-hydroxycyclohexyl]amino]pyrido[3,4-d]pyridazin-1-yl]phenol.
| Compound Name | 5-chloro-2-[4-[[(1R,2R)-3-(2,2-difluoroethylidene)-2-hydroxycyclohexyl]amino]pyrido[3,4-d]pyridazin-1-yl]phenol |
|---|---|
| PubChem CID | 171829531 |
| Molecular Formula | C21H19ClF2N4O2 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 5-chloro-2-[4-[[(1R,2R)-3-(2,2-difluoroethylidene)-2-hydroxycyclohexyl]amino]pyrido[3,4-d]pyridazin-1-yl]phenol |
| SMILES | Oc1cc(Cl)ccc1-c1nnc(N[C@@H]2CCCC(=CC(F)F)[C@H]2O)c2cnccc12 |
| InChI | InChI=1S/C21H19ClF2N4O2/c22-12-4-5-14(17(29)9-12)19-13-6-7-25-10-15(13)21(28-27-19)26-16-3-1-2-11(20(16)30)8-18(23)24/h4-10,16,18,20,29-30H,1-3H2,(H,26,28)/t16-,20-/m1/s1 |
| InChIKey | QZFBIJKZVOLCNQ-OXQOHEQNSA-N |
| XLogP | 4.57 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|