C35H43N2O4P — CID 171830519
cyclobutane;4-(3-diphenylphosphanylcarbonyl-2,4,6-trimethylphenyl)-N-methyl-2-morpholin-4-yl-4-oxobutanamide (PubChem CID 171830519) has the molecular formula C35H43N2O4P and a molecular weight of 586.71 g/mol. Its IUPAC name is cyclobutane;4-(3-diphenylphosphanylcarbonyl-2,4,6-trimethylphenyl)-N-methyl-2-morpholin-4-yl-4-oxobutanamide.
| Compound Name | cyclobutane;4-(3-diphenylphosphanylcarbonyl-2,4,6-trimethylphenyl)-N-methyl-2-morpholin-4-yl-4-oxobutanamide |
|---|---|
| PubChem CID | 171830519 |
| Molecular Formula | C35H43N2O4P |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | cyclobutane;4-(3-diphenylphosphanylcarbonyl-2,4,6-trimethylphenyl)-N-methyl-2-morpholin-4-yl-4-oxobutanamide |
| SMILES | C1CCC1.CNC(=O)C(CC(=O)c1c(C)cc(C)c(C(=O)P(c2ccccc2)c2ccccc2)c1C)N1CCOCC1 |
| InChI | InChI=1S/C31H35N2O4P.C4H8/c1-21-19-22(2)29(31(36)38(24-11-7-5-8-12-24)25-13-9-6-10-14-25)23(3)28(21)27(34)20-26(30(35)32-4)33-15-17-37-18-16-33;1-2-4-3-1/h5-14,19,26H,15-18,20H2,1-4H3,(H,32,35);1-4H2 |
| InChIKey | VCDQDDASZXQYIB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|