C20H13F3N4O3 — CID 171830817
3-[[1-[2-hydroxy-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-yl]amino]benzene-1,2-diol (PubChem CID 171830817) has the molecular formula C20H13F3N4O3 and a molecular weight of 414.34 g/mol. Its IUPAC name is 3-[[1-[2-hydroxy-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-yl]amino]benzene-1,2-diol.
| Compound Name | 3-[[1-[2-hydroxy-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-yl]amino]benzene-1,2-diol |
|---|---|
| PubChem CID | 171830817 |
| Molecular Formula | C20H13F3N4O3 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 3-[[1-[2-hydroxy-4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyridazin-4-yl]amino]benzene-1,2-diol |
| SMILES | Oc1cc(C(F)(F)F)ccc1-c1nnc(Nc2cccc(O)c2O)c2cnccc12 |
| InChI | InChI=1S/C20H13F3N4O3/c21-20(22,23)10-4-5-12(16(29)8-10)17-11-6-7-24-9-13(11)19(27-26-17)25-14-2-1-3-15(28)18(14)30/h1-9,28-30H,(H,25,27) |
| InChIKey | FEGCACYLSUQAEV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|