C15H23ClN4 — CID 171830916
(2Z,4Z)-3-(N'-piperidin-3-ylcarbamimidoyl)-2-[(Z)-prop-1-enyl]hexa-2,4-dienimidoyl chloride (PubChem CID 171830916) has the molecular formula C15H23ClN4 and a molecular weight of 294.83 g/mol. Its IUPAC name is (2Z,4Z)-3-(N'-piperidin-3-ylcarbamimidoyl)-2-[(Z)-prop-1-enyl]hexa-2,4-dienimidoyl chloride.
| Compound Name | (2Z,4Z)-3-(N'-piperidin-3-ylcarbamimidoyl)-2-[(Z)-prop-1-enyl]hexa-2,4-dienimidoyl chloride |
|---|---|
| PubChem CID | 171830916 |
| Molecular Formula | C15H23ClN4 |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (2Z,4Z)-3-(N'-piperidin-3-ylcarbamimidoyl)-2-[(Z)-prop-1-enyl]hexa-2,4-dienimidoyl chloride |
| SMILES | [H]/N=C(Cl)/C(/C=C\C)=C(/C=C\C)C(\N)=N\C1CCCNC1 |
| InChI | InChI=1S/C15H23ClN4/c1-3-6-12(14(16)17)13(7-4-2)15(18)20-11-8-5-9-19-10-11/h3-4,6-7,11,17,19H,5,8-10H2,1-2H3,(H2,18,20)/b6-3-,7-4-,13-12-,17-14- |
| InChIKey | GTIUPKMPBIJVIT-KOLUFINRSA-N |
| XLogP | 2.76 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|