About 2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one
2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one (PubChem CID 171830930) has the molecular formula C19H18F3N5O2
and a molecular weight of 405.38 g/mol. Its IUPAC name is 2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one |
| PubChem CID | 171830930 |
| Molecular Formula | C19H18F3N5O2 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one |
| SMILES | CN1CCCC1=O.Nc1nnc(-c2ccc(C(F)(F)F)cc2O)c2ccncc12 |
| InChI | InChI=1S/C14H9F3N4O.C5H9NO/c15-14(16,17)7-1-2-9(11(22)5-7)12-8-3-4-19-6-10(8)13(18)21-20-12;1-6-4-2-3-5(6)7/h1-6,22H,(H2,18,21);2-4H2,1H3 |
| InChIKey | KBLSPCQQMZWCMW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one?
The IUPAC name of 2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one (CID 171830930) is 2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one.
What is the SMILES notation for 2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one?
The canonical SMILES for 2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one is CN1CCCC1=O.Nc1nnc(-c2ccc(C(F)(F)F)cc2O)c2ccncc12.
What is the InChIKey of 2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one?
The InChIKey is KBLSPCQQMZWCMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3N4O.C5H9NO/c15-14(16,17)7-1-2-9(11(22)5-7)12-8-3-4-19-6-10(8)13(18)21-20-12;1-6-4-2-3-5(6)7/h1-6,22H,(H2,18,21);2-4H2,1H3.
What are the key properties of 2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one?
2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one has a molecular weight of 405.38 g/mol, XLogP of 3.24, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminopyrido[3,4-d]pyridazin-1-yl)-5-(trifluoromethyl)phenol;1-methylpyrrolidin-2-one is sourced from PubChem (CID 171830930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).