About ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium
ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium (PubChem CID 171831040) has the molecular formula C16H25N2O3V-
and a molecular weight of 344.33 g/mol. Its IUPAC name is ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium.
Molecular Properties
| Compound Name | ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium |
| PubChem CID | 171831040 |
| Molecular Formula | C16H25N2O3V- |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium |
| SMILES | CC.CCC(=O)N(C)CCNC(=O)OCc1cc[c-]cc1.[V] |
| InChI | InChI=1S/C14H19N2O3.C2H6.V/c1-3-13(17)16(2)10-9-15-14(18)19-11-12-7-5-4-6-8-12;1-2;/h5-8H,3,9-11H2,1-2H3,(H,15,18);1-2H3;/q-1;; |
| InChIKey | FOMUCVMANYAPLL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium?
The IUPAC name of ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium (CID 171831040) is ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium.
What is the SMILES notation for ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium?
The canonical SMILES for ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium is CC.CCC(=O)N(C)CCNC(=O)OCc1cc[c-]cc1.[V].
What is the InChIKey of ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium?
The InChIKey is FOMUCVMANYAPLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N2O3.C2H6.V/c1-3-13(17)16(2)10-9-15-14(18)19-11-12-7-5-4-6-8-12;1-2;/h5-8H,3,9-11H2,1-2H3,(H,15,18);1-2H3;/q-1;;.
What are the key properties of ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium?
ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium has a molecular weight of 344.33 g/mol, XLogP of 2.61, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;phenylmethyl N-[2-[methyl(propanoyl)amino]ethyl]carbamate;vanadium is sourced from PubChem (CID 171831040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).