C20H26ClNO3 — CID 171831455
tert-butyl 2-(3-chloro-2-cyclopropylphenyl)-1-oxa-6-azaspiro[2.5]octane-6-carboxylate (PubChem CID 171831455) has the molecular formula C20H26ClNO3 and a molecular weight of 363.89 g/mol. Its IUPAC name is tert-butyl 2-(3-chloro-2-cyclopropylphenyl)-1-oxa-6-azaspiro[2.5]octane-6-carboxylate.
| Compound Name | tert-butyl 2-(3-chloro-2-cyclopropylphenyl)-1-oxa-6-azaspiro[2.5]octane-6-carboxylate |
|---|---|
| PubChem CID | 171831455 |
| Molecular Formula | C20H26ClNO3 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | tert-butyl 2-(3-chloro-2-cyclopropylphenyl)-1-oxa-6-azaspiro[2.5]octane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)OC2c1cccc(Cl)c1C1CC1 |
| InChI | InChI=1S/C20H26ClNO3/c1-19(2,3)25-18(23)22-11-9-20(10-12-22)17(24-20)14-5-4-6-15(21)16(14)13-7-8-13/h4-6,13,17H,7-12H2,1-3H3 |
| InChIKey | ACYCBNAVZJKAMH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|