C22H21BF3N5O2 — CID 171831968
CID 171831968 (PubChem CID 171831968) has the molecular formula C22H21BF3N5O2 and a molecular weight of 455.25 g/mol.
| Compound Name | CID 171831968 |
|---|---|
| PubChem CID | 171831968 |
| Molecular Formula | C22H21BF3N5O2 |
| Molecular Weight | 455.25 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(N(Cc2ccc(-c3nnc(C(F)F)o3)cc2F)C(=O)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C22H21BF3N5O2/c1-29-7-9-30(10-8-29)22(32)31(17-4-2-3-16(23)12-17)13-15-6-5-14(11-18(15)24)20-27-28-21(33-20)19(25)26/h2-6,11-12,19H,7-10,13H2,1H3 |
| InChIKey | VXTIJVYKTPADTB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|