C30H36FN3O — CID 171832173
(3E,5E)-1-cyclobutylidene-1-N-(2,3-dihydro-1H-inden-2-yl)-6-N-(3-fluoro-5-methoxyphenyl)-2-propan-2-ylidenehepta-3,5-diene-1,4,6-triamine (PubChem CID 171832173) has the molecular formula C30H36FN3O and a molecular weight of 473.64 g/mol. Its IUPAC name is (3E,5E)-1-cyclobutylidene-1-N-(2,3-dihydro-1H-inden-2-yl)-6-N-(3-fluoro-5-methoxyphenyl)-2-propan-2-ylidenehepta-3,5-diene-1,4,6-triamine.
| Compound Name | (3E,5E)-1-cyclobutylidene-1-N-(2,3-dihydro-1H-inden-2-yl)-6-N-(3-fluoro-5-methoxyphenyl)-2-propan-2-ylidenehepta-3,5-diene-1,4,6-triamine |
|---|---|
| PubChem CID | 171832173 |
| Molecular Formula | C30H36FN3O |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | (3E,5E)-1-cyclobutylidene-1-N-(2,3-dihydro-1H-inden-2-yl)-6-N-(3-fluoro-5-methoxyphenyl)-2-propan-2-ylidenehepta-3,5-diene-1,4,6-triamine |
| SMILES | COc1cc(F)cc(N/C(C)=C/C(N)=C\C(=C(C)C)C(NC2Cc3ccccc3C2)=C2CCC2)c1 |
| InChI | InChI=1S/C30H36FN3O/c1-19(2)29(17-25(32)12-20(3)33-27-15-24(31)16-28(18-27)35-4)30(21-10-7-11-21)34-26-13-22-8-5-6-9-23(22)14-26/h5-6,8-9,12,15-18,26,33-34H,7,10-11,13-14,32H2,1-4H3/b20-12+,25-17+ |
| InChIKey | UOKOPVZPJHEFFW-HDPMRWKWSA-N |
| XLogP | 6.52 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|