C12H8F3N3O — CID 171832453
1-methyl-4-[3-(trifluoromethyl)phenoxy]pyrazole-5-carbonitrile (PubChem CID 171832453) has the molecular formula C12H8F3N3O and a molecular weight of 267.21 g/mol. Its IUPAC name is 1-methyl-4-[3-(trifluoromethyl)phenoxy]pyrazole-5-carbonitrile.
| Compound Name | 1-methyl-4-[3-(trifluoromethyl)phenoxy]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 171832453 |
| Molecular Formula | C12H8F3N3O |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1-methyl-4-[3-(trifluoromethyl)phenoxy]pyrazole-5-carbonitrile |
| SMILES | Cn1ncc(Oc2cccc(C(F)(F)F)c2)c1C#N |
| InChI | InChI=1S/C12H8F3N3O/c1-18-10(6-16)11(7-17-18)19-9-4-2-3-8(5-9)12(13,14)15/h2-5,7H,1H3 |
| InChIKey | XSBSQBLIEGVQFF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |