C26H32N4O5 — CID 171832503
methyl 2-methyl-6-[1-methyl-5-[(4R)-4-methyl-5-(phenylmethoxycarbonylamino)pentoxy]pyrazol-4-yl]pyridine-4-carboxylate (PubChem CID 171832503) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is methyl 2-methyl-6-[1-methyl-5-[(4R)-4-methyl-5-(phenylmethoxycarbonylamino)pentoxy]pyrazol-4-yl]pyridine-4-carboxylate.
| Compound Name | methyl 2-methyl-6-[1-methyl-5-[(4R)-4-methyl-5-(phenylmethoxycarbonylamino)pentoxy]pyrazol-4-yl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 171832503 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | methyl 2-methyl-6-[1-methyl-5-[(4R)-4-methyl-5-(phenylmethoxycarbonylamino)pentoxy]pyrazol-4-yl]pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(C)nc(-c2cnn(C)c2OCCC[C@@H](C)CNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H32N4O5/c1-18(15-27-26(32)35-17-20-10-6-5-7-11-20)9-8-12-34-24-22(16-28-30(24)3)23-14-21(25(31)33-4)13-19(2)29-23/h5-7,10-11,13-14,16,18H,8-9,12,15,17H2,1-4H3,(H,27,32)/t18-/m1/s1 |
| InChIKey | SBVMBQJAIALDNN-GOSISDBHSA-N |
| XLogP | 4.30 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|