C9H12FN — CID 171833394
6-fluoro-2-methyl-1,3,4,5-tetrahydroisoindole (PubChem CID 171833394) has the molecular formula C9H12FN and a molecular weight of 153.20 g/mol. Its IUPAC name is 6-fluoro-2-methyl-1,3,4,5-tetrahydroisoindole.
| Compound Name | 6-fluoro-2-methyl-1,3,4,5-tetrahydroisoindole |
|---|---|
| PubChem CID | 171833394 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 6-fluoro-2-methyl-1,3,4,5-tetrahydroisoindole |
| SMILES | CN1CC2=C(CCC(F)=C2)C1 |
| InChI | InChI=1S/C9H12FN/c1-11-5-7-2-3-9(10)4-8(7)6-11/h4H,2-3,5-6H2,1H3 |
| InChIKey | WROJECBJHDUOOP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |