About (NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane
(NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane (PubChem CID 171834010) has the molecular formula C14H27NO3S
and a molecular weight of 289.44 g/mol. Its IUPAC name is (NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane.
Molecular Properties
| Compound Name | (NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane |
| PubChem CID | 171834010 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane |
| SMILES | CC.CC(C)(C)S(=O)/N=C1\CCCCC12OCCO2 |
| InChI | InChI=1S/C12H21NO3S.C2H6/c1-11(2,3)17(14)13-10-6-4-5-7-12(10)15-8-9-16-12;1-2/h4-9H2,1-3H3;1-2H3/b13-10+; |
| InChIKey | MQPHYDOFPOMCDV-RSGUCCNWSA-N |
| XLogP | 3.23 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane?
The IUPAC name of (NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane (CID 171834010) is (NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane.
What is the SMILES notation for (NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane?
The canonical SMILES for (NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane is CC.CC(C)(C)S(=O)/N=C1\CCCCC12OCCO2.
What is the InChIKey of (NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane?
The InChIKey is MQPHYDOFPOMCDV-RSGUCCNWSA-N. The full InChI is InChI=1S/C12H21NO3S.C2H6/c1-11(2,3)17(14)13-10-6-4-5-7-12(10)15-8-9-16-12;1-2/h4-9H2,1-3H3;1-2H3/b13-10+;.
What are the key properties of (NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane?
(NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane has a molecular weight of 289.44 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-(1,4-dioxaspiro[4.5]decan-6-ylidene)-2-methylpropane-2-sulfinamide;ethane is sourced from PubChem (CID 171834010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).