About (3S)-3-butyl-3-methylpyrrolidine;ethane;propane
(3S)-3-butyl-3-methylpyrrolidine;ethane;propane (PubChem CID 171834249) has the molecular formula C14H33N
and a molecular weight of 215.42 g/mol. Its IUPAC name is (3S)-3-butyl-3-methylpyrrolidine;ethane;propane.
Molecular Properties
| Compound Name | (3S)-3-butyl-3-methylpyrrolidine;ethane;propane |
| PubChem CID | 171834249 |
| Molecular Formula | C14H33N |
| Molecular Weight | 215.42 g/mol |
| Exact Mass | 215.26 |
| IUPAC Name | (3S)-3-butyl-3-methylpyrrolidine;ethane;propane |
| SMILES | CC.CCC.CCCC[C@@]1(C)CCNC1 |
| InChI | InChI=1S/C9H19N.C3H8.C2H6/c1-3-4-5-9(2)6-7-10-8-9;1-3-2;1-2/h10H,3-8H2,1-2H3;3H2,1-2H3;1-2H3/t9-;;/m0../s1 |
| InChIKey | NPGWAYLTUDRPQB-WWPIYYJJSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-3-butyl-3-methylpyrrolidine;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-butyl-3-methylpyrrolidine;ethane;propane?
The IUPAC name of (3S)-3-butyl-3-methylpyrrolidine;ethane;propane (CID 171834249) is (3S)-3-butyl-3-methylpyrrolidine;ethane;propane.
What is the SMILES notation for (3S)-3-butyl-3-methylpyrrolidine;ethane;propane?
The canonical SMILES for (3S)-3-butyl-3-methylpyrrolidine;ethane;propane is CC.CCC.CCCC[C@@]1(C)CCNC1.
What is the InChIKey of (3S)-3-butyl-3-methylpyrrolidine;ethane;propane?
The InChIKey is NPGWAYLTUDRPQB-WWPIYYJJSA-N. The full InChI is InChI=1S/C9H19N.C3H8.C2H6/c1-3-4-5-9(2)6-7-10-8-9;1-3-2;1-2/h10H,3-8H2,1-2H3;3H2,1-2H3;1-2H3/t9-;;/m0../s1.
What are the key properties of (3S)-3-butyl-3-methylpyrrolidine;ethane;propane?
(3S)-3-butyl-3-methylpyrrolidine;ethane;propane has a molecular weight of 215.42 g/mol, XLogP of 4.62, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-butyl-3-methylpyrrolidine;ethane;propane is sourced from PubChem (CID 171834249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).