C15H22FNO2 — CID 171834277
tert-butyl 7-(3-fluoro-1-bicyclo[1.1.0]butanyl)-5-azaspiro[2.4]heptane-5-carboxylate (PubChem CID 171834277) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is tert-butyl 7-(3-fluoro-1-bicyclo[1.1.0]butanyl)-5-azaspiro[2.4]heptane-5-carboxylate.
| Compound Name | tert-butyl 7-(3-fluoro-1-bicyclo[1.1.0]butanyl)-5-azaspiro[2.4]heptane-5-carboxylate |
|---|---|
| PubChem CID | 171834277 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | tert-butyl 7-(3-fluoro-1-bicyclo[1.1.0]butanyl)-5-azaspiro[2.4]heptane-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C23CC2(F)C3)C2(CC2)C1 |
| InChI | InChI=1S/C15H22FNO2/c1-12(2,3)19-11(18)17-6-10(13(9-17)4-5-13)14-7-15(14,16)8-14/h10H,4-9H2,1-3H3 |
| InChIKey | NEYRDIWNBFXOFY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |