C19H16F5N7O — CID 171836331
1-[4-[2-[[1-(2,2,3,3,3-pentafluoropropyl)pyrazol-4-yl]amino]pyrimidin-4-yl]phenyl]imidazolidin-2-one (PubChem CID 171836331) has the molecular formula C19H16F5N7O and a molecular weight of 453.38 g/mol. Its IUPAC name is 1-[4-[2-[[1-(2,2,3,3,3-pentafluoropropyl)pyrazol-4-yl]amino]pyrimidin-4-yl]phenyl]imidazolidin-2-one.
| Compound Name | 1-[4-[2-[[1-(2,2,3,3,3-pentafluoropropyl)pyrazol-4-yl]amino]pyrimidin-4-yl]phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 171836331 |
| Molecular Formula | C19H16F5N7O |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 1-[4-[2-[[1-(2,2,3,3,3-pentafluoropropyl)pyrazol-4-yl]amino]pyrimidin-4-yl]phenyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1c1ccc(-c2ccnc(Nc3cnn(CC(F)(F)C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C19H16F5N7O/c20-18(21,19(22,23)24)11-30-10-13(9-27-30)28-16-25-6-5-15(29-16)12-1-3-14(4-2-12)31-8-7-26-17(31)32/h1-6,9-10H,7-8,11H2,(H,26,32)(H,25,28,29) |
| InChIKey | SGALSDGIRNPZEV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|