C36H28F7N7O7 — CID 171837542
[2-[1-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-5-oxopentyl]triazol-4-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate (PubChem CID 171837542) has the molecular formula C36H28F7N7O7 and a molecular weight of 803.65 g/mol. Its IUPAC name is [2-[1-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-5-oxopentyl]triazol-4-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate.
| Compound Name | [2-[1-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-5-oxopentyl]triazol-4-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 171837542 |
| Molecular Formula | C36H28F7N7O7 |
| Molecular Weight | 803.65 g/mol |
| Exact Mass | 803.19 |
| IUPAC Name | [2-[1-[5-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-5-oxopentyl]triazol-4-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate |
| SMILES | CN(C(=O)Oc1c(-c2cn(CCCCC(=O)Nc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)nn2)cc(C(F)(F)F)cc1C(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C36H28F7N7O7/c1-48(20-10-8-19(37)9-11-20)34(56)57-30-22(15-18(35(38,39)40)16-23(30)36(41,42)43)25-17-49(47-46-25)14-3-2-7-27(51)44-24-6-4-5-21-29(24)33(55)50(32(21)54)26-12-13-28(52)45-31(26)53/h4-6,8-11,15-17,26H,2-3,7,12-14H2,1H3,(H,44,51)(H,45,52,53) |
| InChIKey | IFKUWHCIFRPNNX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 172.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|