C18H12F6N2O — CID 171837626
4-[2-phenylmethoxy-3,5-bis(trifluoromethyl)phenyl]-1H-pyrazole (PubChem CID 171837626) has the molecular formula C18H12F6N2O and a molecular weight of 386.30 g/mol. Its IUPAC name is 4-[2-phenylmethoxy-3,5-bis(trifluoromethyl)phenyl]-1H-pyrazole.
| Compound Name | 4-[2-phenylmethoxy-3,5-bis(trifluoromethyl)phenyl]-1H-pyrazole |
|---|---|
| PubChem CID | 171837626 |
| Molecular Formula | C18H12F6N2O |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 4-[2-phenylmethoxy-3,5-bis(trifluoromethyl)phenyl]-1H-pyrazole |
| SMILES | FC(F)(F)c1cc(-c2cn[nH]c2)c(OCc2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12F6N2O/c19-17(20,21)13-6-14(12-8-25-26-9-12)16(15(7-13)18(22,23)24)27-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,25,26) |
| InChIKey | GYIONTFIHWGHIN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |