C28H39F2N5O2 — CID 171837770
1-(3-aminoazetidin-1-yl)-2-[(3R)-3-[[(1Z,3E)-1-[4-(1,1-difluoropropyl)-2-hydroxyphenyl]-2-methyl-1-(methylideneamino)hepta-1,3,6-trien-4-yl]amino]piperidin-1-yl]ethanone (PubChem CID 171837770) has the molecular formula C28H39F2N5O2 and a molecular weight of 515.65 g/mol. Its IUPAC name is 1-(3-aminoazetidin-1-yl)-2-[(3R)-3-[[(1Z,3E)-1-[4-(1,1-difluoropropyl)-2-hydroxyphenyl]-2-methyl-1-(methylideneamino)hepta-1,3,6-trien-4-yl]amino]piperidin-1-yl]ethanone.
| Compound Name | 1-(3-aminoazetidin-1-yl)-2-[(3R)-3-[[(1Z,3E)-1-[4-(1,1-difluoropropyl)-2-hydroxyphenyl]-2-methyl-1-(methylideneamino)hepta-1,3,6-trien-4-yl]amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 171837770 |
| Molecular Formula | C28H39F2N5O2 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | 1-(3-aminoazetidin-1-yl)-2-[(3R)-3-[[(1Z,3E)-1-[4-(1,1-difluoropropyl)-2-hydroxyphenyl]-2-methyl-1-(methylideneamino)hepta-1,3,6-trien-4-yl]amino]piperidin-1-yl]ethanone |
| SMILES | C=CC/C(=C\C(C)=C(/N=C)c1ccc(C(F)(F)CC)cc1O)N[C@@H]1CCCN(CC(=O)N2CC(N)C2)C1 |
| InChI | InChI=1S/C28H39F2N5O2/c1-5-8-22(33-23-9-7-12-34(17-23)18-26(37)35-15-21(31)16-35)13-19(3)27(32-4)24-11-10-20(14-25(24)36)28(29,30)6-2/h5,10-11,13-14,21,23,33,36H,1,4,6-9,12,15-18,31H2,2-3H3/b22-13+,27-19-/t23-/m1/s1 |
| InChIKey | TYXUZLJRYRVXNM-JPTUCNLWSA-N |
| XLogP | 4.01 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|