About 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine
4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine (PubChem CID 171837819) has the molecular formula C11H15ClN4O
and a molecular weight of 254.72 g/mol. Its IUPAC name is 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine.
Molecular Properties
| Compound Name | 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine |
| PubChem CID | 171837819 |
| Molecular Formula | C11H15ClN4O |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine |
| SMILES | Clc1nnc(N[C@@H]2CCCNC2)c2c1COC2 |
| InChI | InChI=1S/C11H15ClN4O/c12-10-8-5-17-6-9(8)11(16-15-10)14-7-2-1-3-13-4-7/h7,13H,1-6H2,(H,14,16)/t7-/m1/s1 |
| InChIKey | HRXQTFXKUGBGIZ-SSDOTTSWSA-N |
| XLogP | 1.32 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine?
The IUPAC name of 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine (CID 171837819) is 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine.
What is the SMILES notation for 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine?
The canonical SMILES for 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine is Clc1nnc(N[C@@H]2CCCNC2)c2c1COC2.
What is the InChIKey of 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine?
The InChIKey is HRXQTFXKUGBGIZ-SSDOTTSWSA-N. The full InChI is InChI=1S/C11H15ClN4O/c12-10-8-5-17-6-9(8)11(16-15-10)14-7-2-1-3-13-4-7/h7,13H,1-6H2,(H,14,16)/t7-/m1/s1.
What are the key properties of 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine?
4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine has a molecular weight of 254.72 g/mol, XLogP of 1.32, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(3R)-piperidin-3-yl]-5,7-dihydrofuro[3,4-d]pyridazin-1-amine is sourced from PubChem (CID 171837819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).