C17H23F3N4O — CID 171837854
2-[(1Z,3E)-1,4-diamino-2-methyl-4-(piperidin-3-ylamino)buta-1,3-dienyl]-5-(trifluoromethyl)phenol (PubChem CID 171837854) has the molecular formula C17H23F3N4O and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-[(1Z,3E)-1,4-diamino-2-methyl-4-(piperidin-3-ylamino)buta-1,3-dienyl]-5-(trifluoromethyl)phenol.
| Compound Name | 2-[(1Z,3E)-1,4-diamino-2-methyl-4-(piperidin-3-ylamino)buta-1,3-dienyl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 171837854 |
| Molecular Formula | C17H23F3N4O |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 2-[(1Z,3E)-1,4-diamino-2-methyl-4-(piperidin-3-ylamino)buta-1,3-dienyl]-5-(trifluoromethyl)phenol |
| SMILES | CC(/C=C(\N)NC1CCCNC1)=C(/N)c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C17H23F3N4O/c1-10(7-15(21)24-12-3-2-6-23-9-12)16(22)13-5-4-11(8-14(13)25)17(18,19)20/h4-5,7-8,12,23-25H,2-3,6,9,21-22H2,1H3/b15-7+,16-10- |
| InChIKey | KOFLMXBZXRMAMS-CECBYWJVSA-N |
| XLogP | 2.24 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|