C16H22F3N3O — CID 171837873
2-[(1Z,3E)-1,4-diamino-4-(butan-2-ylamino)-2-methylbuta-1,3-dienyl]-5-(trifluoromethyl)phenol (PubChem CID 171837873) has the molecular formula C16H22F3N3O and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-[(1Z,3E)-1,4-diamino-4-(butan-2-ylamino)-2-methylbuta-1,3-dienyl]-5-(trifluoromethyl)phenol.
| Compound Name | 2-[(1Z,3E)-1,4-diamino-4-(butan-2-ylamino)-2-methylbuta-1,3-dienyl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 171837873 |
| Molecular Formula | C16H22F3N3O |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-[(1Z,3E)-1,4-diamino-4-(butan-2-ylamino)-2-methylbuta-1,3-dienyl]-5-(trifluoromethyl)phenol |
| SMILES | CCC(C)N/C(N)=C/C(C)=C(\N)c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C16H22F3N3O/c1-4-10(3)22-14(20)7-9(2)15(21)12-6-5-11(8-13(12)23)16(17,18)19/h5-8,10,22-23H,4,20-21H2,1-3H3/b14-7+,15-9- |
| InChIKey | BMKYWMPJLILBDS-RTEVRSITSA-N |
| XLogP | 3.29 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|