C24H35F2N4OP — CID 171838150
2-[(1Z,3E)-1,4-diamino-4-[[(3R)-1-(2-cyclobutylidenepropyl)piperidin-3-yl]amino]-2-methylbuta-1,3-dienyl]-5-[difluoro(phosphanyl)methyl]phenol (PubChem CID 171838150) has the molecular formula C24H35F2N4OP and a molecular weight of 464.54 g/mol. Its IUPAC name is 2-[(1Z,3E)-1,4-diamino-4-[[(3R)-1-(2-cyclobutylidenepropyl)piperidin-3-yl]amino]-2-methylbuta-1,3-dienyl]-5-[difluoro(phosphanyl)methyl]phenol.
| Compound Name | 2-[(1Z,3E)-1,4-diamino-4-[[(3R)-1-(2-cyclobutylidenepropyl)piperidin-3-yl]amino]-2-methylbuta-1,3-dienyl]-5-[difluoro(phosphanyl)methyl]phenol |
|---|---|
| PubChem CID | 171838150 |
| Molecular Formula | C24H35F2N4OP |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 2-[(1Z,3E)-1,4-diamino-4-[[(3R)-1-(2-cyclobutylidenepropyl)piperidin-3-yl]amino]-2-methylbuta-1,3-dienyl]-5-[difluoro(phosphanyl)methyl]phenol |
| SMILES | CC(CN1CCC[C@@H](N/C(N)=C/C(C)=C(\N)c2ccc(C(F)(F)P)cc2O)C1)=C1CCC1 |
| InChI | InChI=1S/C24H35F2N4OP/c1-15(23(28)20-9-8-18(12-21(20)31)24(25,26)32)11-22(27)29-19-7-4-10-30(14-19)13-16(2)17-5-3-6-17/h8-9,11-12,19,29,31H,3-7,10,13-14,27-28,32H2,1-2H3/b22-11+,23-15-/t19-/m1/s1 |
| InChIKey | PHZJQWPWGYYADS-HCYJBNTLSA-N |
| XLogP | 4.36 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|