About lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one
lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one (PubChem CID 171838239) has the molecular formula C8H7Cl2LiN2O
and a molecular weight of 225.00 g/mol. Its IUPAC name is lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one.
Molecular Properties
| Compound Name | lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one |
| PubChem CID | 171838239 |
| Molecular Formula | C8H7Cl2LiN2O |
| Molecular Weight | 225.00 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one |
| SMILES | Cc1c(Cl)nnc(Cl)c1CC[C-]=O.[Li+] |
| InChI | InChI=1S/C8H7Cl2N2O.Li/c1-5-6(3-2-4-13)8(10)12-11-7(5)9;/h2-3H2,1H3;/q-1;+1 |
| InChIKey | BHDJZIKGEMPVJK-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.00 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one?
The IUPAC name of lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one (CID 171838239) is lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one.
What is the SMILES notation for lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one?
The canonical SMILES for lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one is Cc1c(Cl)nnc(Cl)c1CC[C-]=O.[Li+].
What is the InChIKey of lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one?
The InChIKey is BHDJZIKGEMPVJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl2N2O.Li/c1-5-6(3-2-4-13)8(10)12-11-7(5)9;/h2-3H2,1H3;/q-1;+1.
What are the key properties of lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one?
lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one has a molecular weight of 225.00 g/mol, XLogP of -0.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 3-(3,6-dichloro-5-methylpyridazin-4-yl)propan-1-one is sourced from PubChem (CID 171838239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).