C12H14ClN3O — CID 171838815
5-chloro-2-methyl-3-[[(3R)-oxolan-3-yl]methyl]imidazo[4,5-b]pyridine (PubChem CID 171838815) has the molecular formula C12H14ClN3O and a molecular weight of 251.72 g/mol. Its IUPAC name is 5-chloro-2-methyl-3-[[(3R)-oxolan-3-yl]methyl]imidazo[4,5-b]pyridine.
| Compound Name | 5-chloro-2-methyl-3-[[(3R)-oxolan-3-yl]methyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 171838815 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 5-chloro-2-methyl-3-[[(3R)-oxolan-3-yl]methyl]imidazo[4,5-b]pyridine |
| SMILES | Cc1nc2ccc(Cl)nc2n1C[C@H]1CCOC1 |
| InChI | InChI=1S/C12H14ClN3O/c1-8-14-10-2-3-11(13)15-12(10)16(8)6-9-4-5-17-7-9/h2-3,9H,4-7H2,1H3/t9-/m1/s1 |
| InChIKey | XVQQZNQRAKWHEC-SECBINFHSA-N |
| XLogP | 2.43 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|