C16H18ClN3 — CID 171838933
5-[(2E,4Z)-2-[(Z)-but-1-enyl]hexa-2,4-dienyl]-3-chloropyrrolo[2,3-b]pyrazine (PubChem CID 171838933) has the molecular formula C16H18ClN3 and a molecular weight of 287.79 g/mol. Its IUPAC name is 5-[(2E,4Z)-2-[(Z)-but-1-enyl]hexa-2,4-dienyl]-3-chloropyrrolo[2,3-b]pyrazine.
| Compound Name | 5-[(2E,4Z)-2-[(Z)-but-1-enyl]hexa-2,4-dienyl]-3-chloropyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 171838933 |
| Molecular Formula | C16H18ClN3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 5-[(2E,4Z)-2-[(Z)-but-1-enyl]hexa-2,4-dienyl]-3-chloropyrrolo[2,3-b]pyrazine |
| SMILES | C/C=C\C=C(/C=C\CC)Cn1ccc2ncc(Cl)nc21 |
| InChI | InChI=1S/C16H18ClN3/c1-3-5-7-13(8-6-4-2)12-20-10-9-14-16(20)19-15(17)11-18-14/h3,5-11H,4,12H2,1-2H3/b5-3-,8-6-,13-7+ |
| InChIKey | PNZUCYZGKVHYAO-ZDHGGEHDSA-N |
| XLogP | 4.55 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|